C34H50Cl2N2O2Zr — CID 139252629
bis(2-tert-butyl-6-(cyclohexyliminomethyl)phenol);dichlorozirconium (PubChem CID 139252629) has the molecular formula C34H50Cl2N2O2Zr and a molecular weight of 680.92 g/mol. Its IUPAC name is bis(2-tert-butyl-6-(cyclohexyliminomethyl)phenol);dichlorozirconium.
| Compound Name | bis(2-tert-butyl-6-(cyclohexyliminomethyl)phenol);dichlorozirconium |
|---|---|
| PubChem CID | 139252629 |
| Molecular Formula | C34H50Cl2N2O2Zr |
| Molecular Weight | 680.92 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | bis(2-tert-butyl-6-(cyclohexyliminomethyl)phenol);dichlorozirconium |
| SMILES | CC(C)(C)c1cccc(/C=N/C2CCCCC2)c1O.CC(C)(C)c1cccc(/C=N\C2CCCCC2)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/2C17H25NO.2ClH.Zr/c2*1-17(2,3)15-11-7-8-13(16(15)19)12-18-14-9-5-4-6-10-14;;;/h2*7-8,11-12,14,19H,4-6,9-10H2,1-3H3;2*1H;/q;;;;+2/p-2/b18-12+;18-12-;;; |
| InChIKey | WZHIOWICGDDXAM-GKGOZUBTSA-L |
| XLogP | 10.26 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.92 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|