C17H25Cl2NOTi — CID 175086437
2-tert-butyl-6-(cyclohexyliminomethyl)phenol;dichlorotitanium (PubChem CID 175086437) has the molecular formula C17H25Cl2NOTi and a molecular weight of 378.17 g/mol. Its IUPAC name is 2-tert-butyl-6-(cyclohexyliminomethyl)phenol;dichlorotitanium.
| Compound Name | 2-tert-butyl-6-(cyclohexyliminomethyl)phenol;dichlorotitanium |
|---|---|
| PubChem CID | 175086437 |
| Molecular Formula | C17H25Cl2NOTi |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-tert-butyl-6-(cyclohexyliminomethyl)phenol;dichlorotitanium |
| SMILES | CC(C)(C)c1cccc(/C=N/C2CCCCC2)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/C17H25NO.2ClH.Ti/c1-17(2,3)15-11-7-8-13(16(15)19)12-18-14-9-5-4-6-10-14;;;/h7-8,11-12,14,19H,4-6,9-10H2,1-3H3;2*1H;/q;;;+2/p-2/b18-12+;;; |
| InChIKey | GUOJUJIRNMQFTO-KMDBKMSFSA-L |
| XLogP | 5.82 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|