C21H21Cl2NOTi — CID 175087881
2-tert-butyl-6-(naphthalen-1-yliminomethyl)phenol;dichlorotitanium (PubChem CID 175087881) has the molecular formula C21H21Cl2NOTi and a molecular weight of 422.18 g/mol. Its IUPAC name is 2-tert-butyl-6-(naphthalen-1-yliminomethyl)phenol;dichlorotitanium.
| Compound Name | 2-tert-butyl-6-(naphthalen-1-yliminomethyl)phenol;dichlorotitanium |
|---|---|
| PubChem CID | 175087881 |
| Molecular Formula | C21H21Cl2NOTi |
| Molecular Weight | 422.18 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-tert-butyl-6-(naphthalen-1-yliminomethyl)phenol;dichlorotitanium |
| SMILES | CC(C)(C)c1cccc(/C=N/c2cccc3ccccc23)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/C21H21NO.2ClH.Ti/c1-21(2,3)18-12-6-10-16(20(18)23)14-22-19-13-7-9-15-8-4-5-11-17(15)19;;;/h4-14,23H,1-3H3;2*1H;/q;;;+2/p-2/b22-14+;;; |
| InChIKey | OZAHIBXFRUEZGA-UZCIDVFDSA-L |
| XLogP | 6.97 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.18 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|