C44H54Cl2N2O4Ti — CID 137229364
bis(2-tert-butyl-6-[(4-pent-4-enoxyphenyl)iminomethyl]phenol);dichlorotitanium (PubChem CID 137229364) has the molecular formula C44H54Cl2N2O4Ti and a molecular weight of 793.70 g/mol. Its IUPAC name is bis(2-tert-butyl-6-[(4-pent-4-enoxyphenyl)iminomethyl]phenol);dichlorotitanium.
| Compound Name | bis(2-tert-butyl-6-[(4-pent-4-enoxyphenyl)iminomethyl]phenol);dichlorotitanium |
|---|---|
| PubChem CID | 137229364 |
| Molecular Formula | C44H54Cl2N2O4Ti |
| Molecular Weight | 793.70 g/mol |
| Exact Mass | 792.29 |
| IUPAC Name | bis(2-tert-butyl-6-[(4-pent-4-enoxyphenyl)iminomethyl]phenol);dichlorotitanium |
| SMILES | C=CCCCOc1ccc(/N=C/c2cccc(C(C)(C)C)c2O)cc1.C=CCCCOc1ccc(/N=C\c2cccc(C(C)(C)C)c2O)cc1.Cl[Ti]Cl |
| InChI | InChI=1S/2C22H27NO2.2ClH.Ti/c2*1-5-6-7-15-25-19-13-11-18(12-14-19)23-16-17-9-8-10-20(21(17)24)22(2,3)4;;;/h2*5,8-14,16,24H,1,6-7,15H2,2-4H3;2*1H;/q;;;;+2/p-2/b23-16+;23-16-;;; |
| InChIKey | CFMDBYHCWHHZCT-QNPOIXOQSA-L |
| XLogP | 12.95 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.70 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|