C58H66Cl2N2O4Ti — CID 137225972
bis(4-tert-butyl-2-(2-phenylpropan-2-yl)-6-[(3-prop-2-enoxyphenyl)iminomethyl]phenol);dichlorotitanium (PubChem CID 137225972) has the molecular formula C58H66Cl2N2O4Ti and a molecular weight of 973.95 g/mol. Its IUPAC name is bis(4-tert-butyl-2-(2-phenylpropan-2-yl)-6-[(3-prop-2-enoxyphenyl)iminomethyl]phenol);dichlorotitanium.
| Compound Name | bis(4-tert-butyl-2-(2-phenylpropan-2-yl)-6-[(3-prop-2-enoxyphenyl)iminomethyl]phenol);dichlorotitanium |
|---|---|
| PubChem CID | 137225972 |
| Molecular Formula | C58H66Cl2N2O4Ti |
| Molecular Weight | 973.95 g/mol |
| Exact Mass | 972.39 |
| IUPAC Name | bis(4-tert-butyl-2-(2-phenylpropan-2-yl)-6-[(3-prop-2-enoxyphenyl)iminomethyl]phenol);dichlorotitanium |
| SMILES | C=CCOc1cccc(/N=C/c2cc(C(C)(C)C)cc(C(C)(C)c3ccccc3)c2O)c1.C=CCOc1cccc(/N=C\c2cc(C(C)(C)C)cc(C(C)(C)c3ccccc3)c2O)c1.Cl[Ti]Cl |
| InChI | InChI=1S/2C29H33NO2.2ClH.Ti/c2*1-7-16-32-25-15-11-14-24(19-25)30-20-21-17-23(28(2,3)4)18-26(27(21)31)29(5,6)22-12-9-8-10-13-22;;;/h2*7-15,17-20,31H,1,16H2,2-6H3;2*1H;/q;;;;+2/p-2/b30-20+;30-20-;;; |
| InChIKey | OTBJMELDLWNMIM-ZHCBZJAISA-L |
| XLogP | 16.04 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.95 |
| LogP ≤ 5 | 16.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|