C33H35NO2 — CID 136760092
2-[[(1R)-2-hydroxy-1-phenylethyl]iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol (PubChem CID 136760092) has the molecular formula C33H35NO2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-[[(1R)-2-hydroxy-1-phenylethyl]iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol.
| Compound Name | 2-[[(1R)-2-hydroxy-1-phenylethyl]iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 136760092 |
| Molecular Formula | C33H35NO2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 2-[[(1R)-2-hydroxy-1-phenylethyl]iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol |
| SMILES | CC(C)(c1ccccc1)c1cc(/C=N/[C@@H](CO)c2ccccc2)c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C33H35NO2/c1-32(2,26-16-10-6-11-17-26)28-20-25(22-34-30(23-35)24-14-8-5-9-15-24)31(36)29(21-28)33(3,4)27-18-12-7-13-19-27/h5-22,30,35-36H,23H2,1-4H3/b34-22+/t30-/m0/s1 |
| InChIKey | QSEDLGLIUUQZPK-QXNHYZTASA-N |
| XLogP | 7.20 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|