C25H28OS — CID 89410298
2,4-bis(2-phenylpropan-2-yl)-6-(sulfanylmethyl)phenol (PubChem CID 89410298) has the molecular formula C25H28OS and a molecular weight of 376.57 g/mol. Its IUPAC name is 2,4-bis(2-phenylpropan-2-yl)-6-(sulfanylmethyl)phenol.
| Compound Name | 2,4-bis(2-phenylpropan-2-yl)-6-(sulfanylmethyl)phenol |
|---|---|
| PubChem CID | 89410298 |
| Molecular Formula | C25H28OS |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2,4-bis(2-phenylpropan-2-yl)-6-(sulfanylmethyl)phenol |
| SMILES | CC(C)(c1ccccc1)c1cc(CS)c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H28OS/c1-24(2,19-11-7-5-8-12-19)21-15-18(17-27)23(26)22(16-21)25(3,4)20-13-9-6-10-14-20/h5-16,26-27H,17H2,1-4H3 |
| InChIKey | YRRBEYSYIJDJJE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|