C25H26O4 — CID 21413982
2,6-dihydroxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid (PubChem CID 21413982) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2,6-dihydroxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid.
| Compound Name | 2,6-dihydroxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 21413982 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2,6-dihydroxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid |
| SMILES | CC(C)(c1ccccc1)c1cc(C(C)(C)c2ccccc2)c(O)c(C(=O)O)c1O |
| InChI | InChI=1S/C25H26O4/c1-24(2,16-11-7-5-8-12-16)18-15-19(22(27)20(21(18)26)23(28)29)25(3,4)17-13-9-6-10-14-17/h5-15,26-27H,1-4H3,(H,28,29) |
| InChIKey | FWMQXFHMDXWEGE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |