C25H26N2O3 — CID 136883517
2,6-bis[[(1R)-2-hydroxy-1-phenylethyl]iminomethyl]-4-methylphenol (PubChem CID 136883517) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2,6-bis[[(1R)-2-hydroxy-1-phenylethyl]iminomethyl]-4-methylphenol.
| Compound Name | 2,6-bis[[(1R)-2-hydroxy-1-phenylethyl]iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 136883517 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2,6-bis[[(1R)-2-hydroxy-1-phenylethyl]iminomethyl]-4-methylphenol |
| SMILES | Cc1cc(/C=N/[C@@H](CO)c2ccccc2)c(O)c(/C=N/[C@@H](CO)c2ccccc2)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-18-12-21(14-26-23(16-28)19-8-4-2-5-9-19)25(30)22(13-18)15-27-24(17-29)20-10-6-3-7-11-20/h2-15,23-24,28-30H,16-17H2,1H3/b26-14+,27-15+/t23-,24-/m0/s1 |
| InChIKey | UBRCSUOTCTVUBV-VYLGSPJQSA-N |
| XLogP | 4.01 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|