C14H14BrNO2 — CID 59664764
(2R)-2-[(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-phenylethanol (PubChem CID 59664764) has the molecular formula C14H14BrNO2 and a molecular weight of 308.18 g/mol. Its IUPAC name is (2R)-2-[(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-phenylethanol.
| Compound Name | (2R)-2-[(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-phenylethanol |
|---|---|
| PubChem CID | 59664764 |
| Molecular Formula | C14H14BrNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (2R)-2-[(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-phenylethanol |
| SMILES | Cc1oc(/C=N/[C@@H](CO)c2ccccc2)cc1Br |
| InChI | InChI=1S/C14H14BrNO2/c1-10-13(15)7-12(18-10)8-16-14(9-17)11-5-3-2-4-6-11/h2-8,14,17H,9H2,1H3/b16-8+/t14-/m0/s1 |
| InChIKey | JJFKUWMTJDADSY-BRSWLGOBSA-N |
| XLogP | 3.50 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|