C16H20BrNO2 — CID 59664765
(2R)-2-[[(1R)-1-(4-bromo-5-methylfuran-2-yl)propyl]amino]-2-phenylethanol (PubChem CID 59664765) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is (2R)-2-[[(1R)-1-(4-bromo-5-methylfuran-2-yl)propyl]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[[(1R)-1-(4-bromo-5-methylfuran-2-yl)propyl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 59664765 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (2R)-2-[[(1R)-1-(4-bromo-5-methylfuran-2-yl)propyl]amino]-2-phenylethanol |
| SMILES | CC[C@@H](N[C@@H](CO)c1ccccc1)c1cc(Br)c(C)o1 |
| InChI | InChI=1S/C16H20BrNO2/c1-3-14(16-9-13(17)11(2)20-16)18-15(10-19)12-7-5-4-6-8-12/h4-9,14-15,18-19H,3,10H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | PDCWZHJOPHXIBE-CABCVRRESA-N |
| XLogP | 4.12 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |