C16H21NO2 — CID 107093791
(2R)-2-[1-(2,5-dimethylfuran-3-yl)ethylamino]-2-phenylethanol (PubChem CID 107093791) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2R)-2-[1-(2,5-dimethylfuran-3-yl)ethylamino]-2-phenylethanol.
| Compound Name | (2R)-2-[1-(2,5-dimethylfuran-3-yl)ethylamino]-2-phenylethanol |
|---|---|
| PubChem CID | 107093791 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2R)-2-[1-(2,5-dimethylfuran-3-yl)ethylamino]-2-phenylethanol |
| SMILES | Cc1cc(C(C)N[C@@H](CO)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C16H21NO2/c1-11-9-15(13(3)19-11)12(2)17-16(10-18)14-7-5-4-6-8-14/h4-9,12,16-18H,10H2,1-3H3/t12?,16-/m0/s1 |
| InChIKey | CPWKTJASWULXHV-INSVYWFGSA-N |
| XLogP | 3.28 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |