C18H19NO2 — CID 103784129
(2S)-2-[1-(1-benzofuran-2-yl)ethylamino]-2-phenylethanol (PubChem CID 103784129) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2S)-2-[1-(1-benzofuran-2-yl)ethylamino]-2-phenylethanol.
| Compound Name | (2S)-2-[1-(1-benzofuran-2-yl)ethylamino]-2-phenylethanol |
|---|---|
| PubChem CID | 103784129 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2S)-2-[1-(1-benzofuran-2-yl)ethylamino]-2-phenylethanol |
| SMILES | CC(N[C@H](CO)c1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H19NO2/c1-13(18-11-15-9-5-6-10-17(15)21-18)19-16(12-20)14-7-3-2-4-8-14/h2-11,13,16,19-20H,12H2,1H3/t13?,16-/m1/s1 |
| InChIKey | DXDYAHJRHGBBSE-FQNRMIAFSA-N |
| XLogP | 3.82 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |