C11H19NO3 — CID 65312937
2-[1-(2,5-dimethylfuran-3-yl)ethylamino]propane-1,3-diol (PubChem CID 65312937) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylfuran-3-yl)ethylamino]propane-1,3-diol.
| Compound Name | 2-[1-(2,5-dimethylfuran-3-yl)ethylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 65312937 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-[1-(2,5-dimethylfuran-3-yl)ethylamino]propane-1,3-diol |
| SMILES | Cc1cc(C(C)NC(CO)CO)c(C)o1 |
| InChI | InChI=1S/C11H19NO3/c1-7-4-11(9(3)15-7)8(2)12-10(5-13)6-14/h4,8,10,12-14H,5-6H2,1-3H3 |
| InChIKey | OSYFGYRURICBDH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |