C22H35NO2Si — CID 70803793
(1R)-1-(5-methyl-4-propan-2-ylfuran-2-yl)-N-[(1R)-1-phenyl-2-trimethylsilyloxyethyl]propan-1-amine (PubChem CID 70803793) has the molecular formula C22H35NO2Si and a molecular weight of 373.61 g/mol. Its IUPAC name is (1R)-1-(5-methyl-4-propan-2-ylfuran-2-yl)-N-[(1R)-1-phenyl-2-trimethylsilyloxyethyl]propan-1-amine.
| Compound Name | (1R)-1-(5-methyl-4-propan-2-ylfuran-2-yl)-N-[(1R)-1-phenyl-2-trimethylsilyloxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 70803793 |
| Molecular Formula | C22H35NO2Si |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (1R)-1-(5-methyl-4-propan-2-ylfuran-2-yl)-N-[(1R)-1-phenyl-2-trimethylsilyloxyethyl]propan-1-amine |
| SMILES | CC[C@@H](N[C@@H](CO[Si](C)(C)C)c1ccccc1)c1cc(C(C)C)c(C)o1 |
| InChI | InChI=1S/C22H35NO2Si/c1-8-20(22-14-19(16(2)3)17(4)25-22)23-21(15-24-26(5,6)7)18-12-10-9-11-13-18/h9-14,16,20-21,23H,8,15H2,1-7H3/t20-,21+/m1/s1 |
| InChIKey | TWOZXJZMXHAAMK-RTWAWAEBSA-N |
| XLogP | 6.34 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|