C16H25NO2 — CID 137060299
2-ethyl-6-[(1-hydroxy-3,3-dimethylbutan-2-yl)iminomethyl]-4-methylphenol (PubChem CID 137060299) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-ethyl-6-[(1-hydroxy-3,3-dimethylbutan-2-yl)iminomethyl]-4-methylphenol.
| Compound Name | 2-ethyl-6-[(1-hydroxy-3,3-dimethylbutan-2-yl)iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 137060299 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-ethyl-6-[(1-hydroxy-3,3-dimethylbutan-2-yl)iminomethyl]-4-methylphenol |
| SMILES | CCc1cc(C)cc(/C=N/C(CO)C(C)(C)C)c1O |
| InChI | InChI=1S/C16H25NO2/c1-6-12-7-11(2)8-13(15(12)19)9-17-14(10-18)16(3,4)5/h7-9,14,18-19H,6,10H2,1-5H3/b17-9+ |
| InChIKey | GAQIRIOGKCETOY-RQZCQDPDSA-N |
| XLogP | 3.09 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|