C21H35NO2 — CID 141285234
2,3-ditert-butyl-6-[(1-hydroxy-3,3-dimethylbutan-2-yl)iminomethyl]phenol (PubChem CID 141285234) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 2,3-ditert-butyl-6-[(1-hydroxy-3,3-dimethylbutan-2-yl)iminomethyl]phenol.
| Compound Name | 2,3-ditert-butyl-6-[(1-hydroxy-3,3-dimethylbutan-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 141285234 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 2,3-ditert-butyl-6-[(1-hydroxy-3,3-dimethylbutan-2-yl)iminomethyl]phenol |
| SMILES | CC(C)(C)c1ccc(/C=N/C(CO)C(C)(C)C)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C21H35NO2/c1-19(2,3)15-11-10-14(18(24)17(15)21(7,8)9)12-22-16(13-23)20(4,5)6/h10-12,16,23-24H,13H2,1-9H3/b22-12+ |
| InChIKey | VKLPSANCRNWFBF-WSDLNYQXSA-N |
| XLogP | 4.81 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|