C15H23ClO — CID 141290648
2,3-ditert-butyl-6-(chloromethyl)phenol (PubChem CID 141290648) has the molecular formula C15H23ClO and a molecular weight of 254.80 g/mol. Its IUPAC name is 2,3-ditert-butyl-6-(chloromethyl)phenol.
| Compound Name | 2,3-ditert-butyl-6-(chloromethyl)phenol |
|---|---|
| PubChem CID | 141290648 |
| Molecular Formula | C15H23ClO |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2,3-ditert-butyl-6-(chloromethyl)phenol |
| SMILES | CC(C)(C)c1ccc(CCl)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C15H23ClO/c1-14(2,3)11-8-7-10(9-16)13(17)12(11)15(4,5)6/h7-8,17H,9H2,1-6H3 |
| InChIKey | OTZSNYKELUUCIN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|