C19H32 — CID 140854295
1,2,4-tritert-butyl-3-methylbenzene (PubChem CID 140854295) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is 1,2,4-tritert-butyl-3-methylbenzene.
| Compound Name | 1,2,4-tritert-butyl-3-methylbenzene |
|---|---|
| PubChem CID | 140854295 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 1,2,4-tritert-butyl-3-methylbenzene |
| SMILES | Cc1c(C(C)(C)C)ccc(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C19H32/c1-13-14(17(2,3)4)11-12-15(18(5,6)7)16(13)19(8,9)10/h11-12H,1-10H3 |
| InChIKey | SHKUMSBRYXXDIY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |