C14H22S — CID 22629957
2,3-ditert-butylbenzenethiol (PubChem CID 22629957) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 2,3-ditert-butylbenzenethiol.
| Compound Name | 2,3-ditert-butylbenzenethiol |
|---|---|
| PubChem CID | 22629957 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2,3-ditert-butylbenzenethiol |
| SMILES | CC(C)(C)c1cccc(S)c1C(C)(C)C |
| InChI | InChI=1S/C14H22S/c1-13(2,3)10-8-7-9-11(15)12(10)14(4,5)6/h7-9,15H,1-6H3 |
| InChIKey | UNHHNSFIQUYOCJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|