C28H46Cl2P2Pd — CID 87225466
bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium (PubChem CID 87225466) has the molecular formula C28H46Cl2P2Pd and a molecular weight of 621.95 g/mol. Its IUPAC name is bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium.
| Compound Name | bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium |
|---|---|
| PubChem CID | 87225466 |
| Molecular Formula | C28H46Cl2P2Pd |
| Molecular Weight | 621.95 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium |
| SMILES | CC(C)(C)c1cccc(P)c1C(C)(C)C.CC(C)(C)c1cccc(P)c1C(C)(C)C.Cl[Pd]Cl |
| InChI | InChI=1S/2C14H23P.2ClH.Pd/c2*1-13(2,3)10-8-7-9-11(15)12(10)14(4,5)6;;;/h2*7-9H,15H2,1-6H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | TVOUDHIMZVREFG-UHFFFAOYSA-L |
| XLogP | 8.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.95 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|