About bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium
bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium (PubChem CID 87225466) has the molecular formula C28H46Cl2P2Pd
and a molecular weight of 621.95 g/mol. Its IUPAC name is bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium.
Molecular Properties
| Compound Name | bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium |
| PubChem CID | 87225466 |
| Molecular Formula | C28H46Cl2P2Pd |
| Molecular Weight | 621.95 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium |
| SMILES | CC(C)(C)c1cccc(P)c1C(C)(C)C.CC(C)(C)c1cccc(P)c1C(C)(C)C.Cl[Pd]Cl |
| InChI | InChI=1S/2C14H23P.2ClH.Pd/c2*1-13(2,3)10-8-7-9-11(15)12(10)14(4,5)6;;;/h2*7-9H,15H2,1-6H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | TVOUDHIMZVREFG-UHFFFAOYSA-L |
| XLogP | 8.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 621.95 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium?
The IUPAC name of bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium (CID 87225466) is bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium.
What is the SMILES notation for bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium?
The canonical SMILES for bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium is CC(C)(C)c1cccc(P)c1C(C)(C)C.CC(C)(C)c1cccc(P)c1C(C)(C)C.Cl[Pd]Cl.
What is the InChIKey of bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium?
The InChIKey is TVOUDHIMZVREFG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H23P.2ClH.Pd/c2*1-13(2,3)10-8-7-9-11(15)12(10)14(4,5)6;;;/h2*7-9H,15H2,1-6H3;2*1H;/q;;;;+2/p-2.
What are the key properties of bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium?
bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium has a molecular weight of 621.95 g/mol, XLogP of 8.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2,3-ditert-butylphenyl)phosphane);dichloropalladium is sourced from PubChem (CID 87225466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).