C26H32BrP — CID 159325523
(2,3-ditert-butylphenyl)-diphenylphosphanium bromide (PubChem CID 159325523) has the molecular formula C26H32BrP and a molecular weight of 455.42 g/mol. Its IUPAC name is (2,3-ditert-butylphenyl)-diphenylphosphanium bromide.
| Compound Name | (2,3-ditert-butylphenyl)-diphenylphosphanium bromide |
|---|---|
| PubChem CID | 159325523 |
| Molecular Formula | C26H32BrP |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (2,3-ditert-butylphenyl)-diphenylphosphanium bromide |
| SMILES | CC(C)(C)c1cccc([PH+](c2ccccc2)c2ccccc2)c1C(C)(C)C.[Br-] |
| InChI | InChI=1S/C26H31P.BrH/c1-25(2,3)22-18-13-19-23(24(22)26(4,5)6)27(20-14-9-7-10-15-20)21-16-11-8-12-17-21;/h7-19H,1-6H3;1H |
| InChIKey | BBVQYEKGEFLBEZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|