C30H44 — CID 90870209
1,2-ditert-butyl-3-(2,2,5,5-tetramethyl-4-phenylhex-3-en-3-yl)benzene (PubChem CID 90870209) has the molecular formula C30H44 and a molecular weight of 404.68 g/mol. Its IUPAC name is 1,2-ditert-butyl-3-(2,2,5,5-tetramethyl-4-phenylhex-3-en-3-yl)benzene.
| Compound Name | 1,2-ditert-butyl-3-(2,2,5,5-tetramethyl-4-phenylhex-3-en-3-yl)benzene |
|---|---|
| PubChem CID | 90870209 |
| Molecular Formula | C30H44 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | 1,2-ditert-butyl-3-(2,2,5,5-tetramethyl-4-phenylhex-3-en-3-yl)benzene |
| SMILES | CC(C)(C)C(=C(c1cccc(C(C)(C)C)c1C(C)(C)C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H44/c1-27(2,3)23-20-16-19-22(25(23)29(7,8)9)26(30(10,11)12)24(28(4,5)6)21-17-14-13-15-18-21/h13-20H,1-12H3 |
| InChIKey | NOXXUCMFNHIAJD-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|