About 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene
1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene (PubChem CID 90450784) has the molecular formula C14H20F2O
and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene |
| PubChem CID | 90450784 |
| Molecular Formula | C14H20F2O |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene |
| SMILES | Cc1c(OC(C)(F)F)ccc(C(C)(C)C)c1C |
| InChI | InChI=1S/C14H20F2O/c1-9-10(2)12(17-14(6,15)16)8-7-11(9)13(3,4)5/h7-8H,1-6H3 |
| InChIKey | WNEWOSDIRSJZCJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene?
The IUPAC name of 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene (CID 90450784) is 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene.
What is the SMILES notation for 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene?
The canonical SMILES for 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene is Cc1c(OC(C)(F)F)ccc(C(C)(C)C)c1C.
What is the InChIKey of 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene?
The InChIKey is WNEWOSDIRSJZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2O/c1-9-10(2)12(17-14(6,15)16)8-7-11(9)13(3,4)5/h7-8H,1-6H3.
What are the key properties of 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene?
1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene has a molecular weight of 242.31 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(1,1-difluoroethoxy)-2,3-dimethylbenzene is sourced from PubChem (CID 90450784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).