C12H16F2O — CID 116841280
1-(1,1-difluoropropyl)-4-methoxy-2,3-dimethylbenzene (PubChem CID 116841280) has the molecular formula C12H16F2O and a molecular weight of 214.25 g/mol. Its IUPAC name is 1-(1,1-difluoropropyl)-4-methoxy-2,3-dimethylbenzene.
| Compound Name | 1-(1,1-difluoropropyl)-4-methoxy-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 116841280 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(1,1-difluoropropyl)-4-methoxy-2,3-dimethylbenzene |
| SMILES | CCC(F)(F)c1ccc(OC)c(C)c1C |
| InChI | InChI=1S/C12H16F2O/c1-5-12(13,14)10-6-7-11(15-4)9(3)8(10)2/h6-7H,5H2,1-4H3 |
| InChIKey | OQOUWFUXAGMIIU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |