C11H16O2 — CID 524865
1-ethyl-2,4-dimethoxy-3-methylbenzene (PubChem CID 524865) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethoxy-3-methylbenzene.
| Compound Name | 1-ethyl-2,4-dimethoxy-3-methylbenzene |
|---|---|
| PubChem CID | 524865 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1-ethyl-2,4-dimethoxy-3-methylbenzene |
| SMILES | CCc1ccc(OC)c(C)c1OC |
| InChI | InChI=1S/C11H16O2/c1-5-9-6-7-10(12-3)8(2)11(9)13-4/h6-7H,5H2,1-4H3 |
| InChIKey | HGZINGCXEMEYCQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |