C13H19NO3 — CID 115234740
1-[(2,4-dimethoxy-3-methylphenyl)methylamino]propan-2-one (PubChem CID 115234740) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-[(2,4-dimethoxy-3-methylphenyl)methylamino]propan-2-one.
| Compound Name | 1-[(2,4-dimethoxy-3-methylphenyl)methylamino]propan-2-one |
|---|---|
| PubChem CID | 115234740 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1-[(2,4-dimethoxy-3-methylphenyl)methylamino]propan-2-one |
| SMILES | COc1ccc(CNCC(C)=O)c(OC)c1C |
| InChI | InChI=1S/C13H19NO3/c1-9(15)7-14-8-11-5-6-12(16-3)10(2)13(11)17-4/h5-6,14H,7-8H2,1-4H3 |
| InChIKey | INABBDOQAFZFOY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |