C19H23NO5 — CID 110783214
N-[(2,4-dimethoxy-3-methylphenyl)methyl]-3,4-dimethoxybenzamide (PubChem CID 110783214) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(2,4-dimethoxy-3-methylphenyl)methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 110783214 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc(OC)c(C)c2OC)cc1OC |
| InChI | InChI=1S/C19H23NO5/c1-12-15(22-2)8-7-14(18(12)25-5)11-20-19(21)13-6-9-16(23-3)17(10-13)24-4/h6-10H,11H2,1-5H3,(H,20,21) |
| InChIKey | FDYRUUIPZSKFIP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |