C12H16ClNO3 — CID 115194800
N-[(2,4-dimethoxy-3-methylphenyl)methyl]-N-methylcarbamoyl chloride (PubChem CID 115194800) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is N-[(2,4-dimethoxy-3-methylphenyl)methyl]-N-methylcarbamoyl chloride.
| Compound Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]-N-methylcarbamoyl chloride |
|---|---|
| PubChem CID | 115194800 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]-N-methylcarbamoyl chloride |
| SMILES | COc1ccc(CN(C)C(=O)Cl)c(OC)c1C |
| InChI | InChI=1S/C12H16ClNO3/c1-8-10(16-3)6-5-9(11(8)17-4)7-14(2)12(13)15/h5-6H,7H2,1-4H3 |
| InChIKey | KLOWEECWQAFMQU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|