C19H23NO3 — CID 110769844
2-(2,4-dimethoxy-3-methylphenyl)-N-ethyl-N-phenylacetamide (PubChem CID 110769844) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-3-methylphenyl)-N-ethyl-N-phenylacetamide.
| Compound Name | 2-(2,4-dimethoxy-3-methylphenyl)-N-ethyl-N-phenylacetamide |
|---|---|
| PubChem CID | 110769844 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-(2,4-dimethoxy-3-methylphenyl)-N-ethyl-N-phenylacetamide |
| SMILES | CCN(C(=O)Cc1ccc(OC)c(C)c1OC)c1ccccc1 |
| InChI | InChI=1S/C19H23NO3/c1-5-20(16-9-7-6-8-10-16)18(21)13-15-11-12-17(22-3)14(2)19(15)23-4/h6-12H,5,13H2,1-4H3 |
| InChIKey | CTXHYOGBALEFPG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |