C35H58 — CID 157157591
1,2-ditert-butyl-3,4,5,6-tetramethylbenzene;1,5-ditert-butyl-2,3,4-trimethylbenzene (PubChem CID 157157591) has the molecular formula C35H58 and a molecular weight of 478.85 g/mol. Its IUPAC name is 1,2-ditert-butyl-3,4,5,6-tetramethylbenzene;1,5-ditert-butyl-2,3,4-trimethylbenzene.
| Compound Name | 1,2-ditert-butyl-3,4,5,6-tetramethylbenzene;1,5-ditert-butyl-2,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 157157591 |
| Molecular Formula | C35H58 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.45 |
| IUPAC Name | 1,2-ditert-butyl-3,4,5,6-tetramethylbenzene;1,5-ditert-butyl-2,3,4-trimethylbenzene |
| SMILES | Cc1c(C(C)(C)C)cc(C(C)(C)C)c(C)c1C.Cc1c(C)c(C)c(C(C)(C)C)c(C(C)(C)C)c1C |
| InChI | InChI=1S/C18H30.C17H28/c1-11-12(2)14(4)16(18(8,9)10)15(13(11)3)17(5,6)7;1-11-12(2)14(16(4,5)6)10-15(13(11)3)17(7,8)9/h1-10H3;10H,1-9H3 |
| InChIKey | ALZOXFVBMGXXRT-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |