C16H26 — CID 159753674
1,2-ditert-butyl-3,5-dimethylbenzene (PubChem CID 159753674) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 1,2-ditert-butyl-3,5-dimethylbenzene.
| Compound Name | 1,2-ditert-butyl-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 159753674 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1,2-ditert-butyl-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)c(C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H26/c1-11-9-12(2)14(16(6,7)8)13(10-11)15(3,4)5/h9-10H,1-8H3 |
| InChIKey | IQXNBVVYCWOBSM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |