C22H26 — CID 59821346
10-tert-butyl-1,3,6,8-tetramethylanthracene (PubChem CID 59821346) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 10-tert-butyl-1,3,6,8-tetramethylanthracene.
| Compound Name | 10-tert-butyl-1,3,6,8-tetramethylanthracene |
|---|---|
| PubChem CID | 59821346 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 10-tert-butyl-1,3,6,8-tetramethylanthracene |
| SMILES | Cc1cc(C)c2cc3c(C)cc(C)cc3c(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C22H26/c1-13-8-15(3)17-12-18-16(4)9-14(2)11-20(18)21(19(17)10-13)22(5,6)7/h8-12H,1-7H3 |
| InChIKey | AHFAVMXYHLGBFP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|