C19H21N — CID 159242363
9-tert-butyl-3,6-dimethylacridine (PubChem CID 159242363) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 9-tert-butyl-3,6-dimethylacridine.
| Compound Name | 9-tert-butyl-3,6-dimethylacridine |
|---|---|
| PubChem CID | 159242363 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 9-tert-butyl-3,6-dimethylacridine |
| SMILES | Cc1ccc2c(C(C)(C)C)c3ccc(C)cc3nc2c1 |
| InChI | InChI=1S/C19H21N/c1-12-6-8-14-16(10-12)20-17-11-13(2)7-9-15(17)18(14)19(3,4)5/h6-11H,1-5H3 |
| InChIKey | YSLXJOZMGKFMMC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|