C20H23N — CID 157493944
9-tert-butyl-2,3,7-trimethylacridine (PubChem CID 157493944) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 9-tert-butyl-2,3,7-trimethylacridine.
| Compound Name | 9-tert-butyl-2,3,7-trimethylacridine |
|---|---|
| PubChem CID | 157493944 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 9-tert-butyl-2,3,7-trimethylacridine |
| SMILES | Cc1ccc2nc3cc(C)c(C)cc3c(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C20H23N/c1-12-7-8-17-15(9-12)19(20(4,5)6)16-10-13(2)14(3)11-18(16)21-17/h7-11H,1-6H3 |
| InChIKey | KAIKCWOXVYGMOX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|