C23H29N — CID 159689701
9-tert-butyl-1,2,3,4,6,7-hexamethylacridine (PubChem CID 159689701) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is 9-tert-butyl-1,2,3,4,6,7-hexamethylacridine.
| Compound Name | 9-tert-butyl-1,2,3,4,6,7-hexamethylacridine |
|---|---|
| PubChem CID | 159689701 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 9-tert-butyl-1,2,3,4,6,7-hexamethylacridine |
| SMILES | Cc1cc2nc3c(C)c(C)c(C)c(C)c3c(C(C)(C)C)c2cc1C |
| InChI | InChI=1S/C23H29N/c1-12-10-18-19(11-13(12)2)24-22-17(6)15(4)14(3)16(5)20(22)21(18)23(7,8)9/h10-11H,1-9H3 |
| InChIKey | LYMCKLSRCIXGGX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|