C21H30 — CID 171579051
2,4-ditert-butyl-1,6,7-trimethylnaphthalene (PubChem CID 171579051) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 2,4-ditert-butyl-1,6,7-trimethylnaphthalene.
| Compound Name | 2,4-ditert-butyl-1,6,7-trimethylnaphthalene |
|---|---|
| PubChem CID | 171579051 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2,4-ditert-butyl-1,6,7-trimethylnaphthalene |
| SMILES | Cc1cc2c(C(C)(C)C)cc(C(C)(C)C)c(C)c2cc1C |
| InChI | InChI=1S/C21H30/c1-13-10-16-15(3)18(20(4,5)6)12-19(21(7,8)9)17(16)11-14(13)2/h10-12H,1-9H3 |
| InChIKey | BKZNVGNIQORBJC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |