C19H26 — CID 171579039
2-tert-butyl-1,7-dimethyl-4-propan-2-ylnaphthalene (PubChem CID 171579039) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-tert-butyl-1,7-dimethyl-4-propan-2-ylnaphthalene.
| Compound Name | 2-tert-butyl-1,7-dimethyl-4-propan-2-ylnaphthalene |
|---|---|
| PubChem CID | 171579039 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 2-tert-butyl-1,7-dimethyl-4-propan-2-ylnaphthalene |
| SMILES | Cc1ccc2c(C(C)C)cc(C(C)(C)C)c(C)c2c1 |
| InChI | InChI=1S/C19H26/c1-12(2)16-11-18(19(5,6)7)14(4)17-10-13(3)8-9-15(16)17/h8-12H,1-7H3 |
| InChIKey | OMAATSDPCAWABY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |