C15H19NO — CID 115063422
4-tert-butyl-2,6-dimethylisoquinolin-1-one (PubChem CID 115063422) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethylisoquinolin-1-one.
| Compound Name | 4-tert-butyl-2,6-dimethylisoquinolin-1-one |
|---|---|
| PubChem CID | 115063422 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 4-tert-butyl-2,6-dimethylisoquinolin-1-one |
| SMILES | Cc1ccc2c(=O)n(C)cc(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C15H19NO/c1-10-6-7-11-12(8-10)13(15(2,3)4)9-16(5)14(11)17/h6-9H,1-5H3 |
| InChIKey | SVCPHNCXEYJABJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |