C17H25N — CID 59882824
3,7-ditert-butyl-1-methylindole (PubChem CID 59882824) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 3,7-ditert-butyl-1-methylindole.
| Compound Name | 3,7-ditert-butyl-1-methylindole |
|---|---|
| PubChem CID | 59882824 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 3,7-ditert-butyl-1-methylindole |
| SMILES | Cn1cc(C(C)(C)C)c2cccc(C(C)(C)C)c21 |
| InChI | InChI=1S/C17H25N/c1-16(2,3)13-10-8-9-12-14(17(4,5)6)11-18(7)15(12)13/h8-11H,1-7H3 |
| InChIKey | PAMXYMPLFZBEKF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |