C14H19ClN2 — CID 84634147
2-(7-chloro-1-methylindol-3-yl)-N,2-dimethylpropan-1-amine (PubChem CID 84634147) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 2-(7-chloro-1-methylindol-3-yl)-N,2-dimethylpropan-1-amine.
| Compound Name | 2-(7-chloro-1-methylindol-3-yl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 84634147 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(7-chloro-1-methylindol-3-yl)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)(C)c1cn(C)c2c(Cl)cccc12 |
| InChI | InChI=1S/C14H19ClN2/c1-14(2,9-16-3)11-8-17(4)13-10(11)6-5-7-12(13)15/h5-8,16H,9H2,1-4H3 |
| InChIKey | HLJDJPZLWRAMPX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |