About 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole
3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole (PubChem CID 13205591) has the molecular formula C29H27N3
and a molecular weight of 417.56 g/mol. Its IUPAC name is 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole.
Molecular Properties
| Compound Name | 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole |
| PubChem CID | 13205591 |
| Molecular Formula | C29H27N3 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole |
| SMILES | Cn1cc(C(C)(c2cn(C)c3ccccc23)c2cn(C)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C29H27N3/c1-29(23-17-30(2)26-14-8-5-11-20(23)26,24-18-31(3)27-15-9-6-12-21(24)27)25-19-32(4)28-16-10-7-13-22(25)28/h5-19H,1-4H3 |
| InChIKey | QFRZAGSYGOQPPT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 14.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole?
The IUPAC name of 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole (CID 13205591) is 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole.
What is the SMILES notation for 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole?
The canonical SMILES for 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole is Cn1cc(C(C)(c2cn(C)c3ccccc23)c2cn(C)c3ccccc23)c2ccccc21.
What is the InChIKey of 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole?
The InChIKey is QFRZAGSYGOQPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27N3/c1-29(23-17-30(2)26-14-8-5-11-20(23)26,24-18-31(3)27-15-9-6-12-21(24)27)25-19-32(4)28-16-10-7-13-22(25)28/h5-19H,1-4H3.
What are the key properties of 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole?
3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole has a molecular weight of 417.56 g/mol, XLogP of 6.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,1-bis(1-methylindol-3-yl)ethyl]-1-methylindole is sourced from PubChem (CID 13205591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).