C24H16F12N2S3 — CID 132839182
3-[1,1,1,3,3,3-hexafluoro-2-[[1,1,1,3,3,3-hexafluoro-2-(1-methylindol-3-yl)propan-2-yl]trisulfanyl]propan-2-yl]-1-methylindole (PubChem CID 132839182) has the molecular formula C24H16F12N2S3 and a molecular weight of 656.58 g/mol. Its IUPAC name is 3-[1,1,1,3,3,3-hexafluoro-2-[[1,1,1,3,3,3-hexafluoro-2-(1-methylindol-3-yl)propan-2-yl]trisulfanyl]propan-2-yl]-1-methylindole.
| Compound Name | 3-[1,1,1,3,3,3-hexafluoro-2-[[1,1,1,3,3,3-hexafluoro-2-(1-methylindol-3-yl)propan-2-yl]trisulfanyl]propan-2-yl]-1-methylindole |
|---|---|
| PubChem CID | 132839182 |
| Molecular Formula | C24H16F12N2S3 |
| Molecular Weight | 656.58 g/mol |
| Exact Mass | 656.03 |
| IUPAC Name | 3-[1,1,1,3,3,3-hexafluoro-2-[[1,1,1,3,3,3-hexafluoro-2-(1-methylindol-3-yl)propan-2-yl]trisulfanyl]propan-2-yl]-1-methylindole |
| SMILES | Cn1cc(C(SSSC(c2cn(C)c3ccccc23)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C24H16F12N2S3/c1-37-11-15(13-7-3-5-9-17(13)37)19(21(25,26)27,22(28,29)30)39-41-40-20(23(31,32)33,24(34,35)36)16-12-38(2)18-10-6-4-8-14(16)18/h3-12H,1-2H3 |
| InChIKey | WDGFKYTYZHUDSL-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.58 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|