C11H8F2N2 — CID 116840601
2,2-difluoro-2-(1-methylindol-3-yl)acetonitrile (PubChem CID 116840601) has the molecular formula C11H8F2N2 and a molecular weight of 206.19 g/mol. Its IUPAC name is 2,2-difluoro-2-(1-methylindol-3-yl)acetonitrile.
| Compound Name | 2,2-difluoro-2-(1-methylindol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 116840601 |
| Molecular Formula | C11H8F2N2 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2,2-difluoro-2-(1-methylindol-3-yl)acetonitrile |
| SMILES | Cn1cc(C(F)(F)C#N)c2ccccc21 |
| InChI | InChI=1S/C11H8F2N2/c1-15-6-9(11(12,13)7-14)8-4-2-3-5-10(8)15/h2-6H,1H3 |
| InChIKey | CBEPXUQCZWONGC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |