C14H17ClN2O — CID 116829549
2-chloro-N-[2-(1-methylindol-3-yl)propan-2-yl]acetamide (PubChem CID 116829549) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 2-chloro-N-[2-(1-methylindol-3-yl)propan-2-yl]acetamide.
| Compound Name | 2-chloro-N-[2-(1-methylindol-3-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 116829549 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-chloro-N-[2-(1-methylindol-3-yl)propan-2-yl]acetamide |
| SMILES | Cn1cc(C(C)(C)NC(=O)CCl)c2ccccc21 |
| InChI | InChI=1S/C14H17ClN2O/c1-14(2,16-13(18)8-15)11-9-17(3)12-7-5-4-6-10(11)12/h4-7,9H,8H2,1-3H3,(H,16,18) |
| InChIKey | HVWCRTMOHIQSCI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|