About 1,3-dimethylindol-7-amine
1,3-dimethylindol-7-amine (PubChem CID 83815699) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,3-dimethylindol-7-amine.
Molecular Properties
| Compound Name | 1,3-dimethylindol-7-amine |
| PubChem CID | 83815699 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,3-dimethylindol-7-amine |
| SMILES | Cc1cn(C)c2c(N)cccc12 |
| InChI | InChI=1S/C10H12N2/c1-7-6-12(2)10-8(7)4-3-5-9(10)11/h3-6H,11H2,1-2H3 |
| InChIKey | YMRVIXQJLTVNRL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylindol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylindol-7-amine?
The IUPAC name of 1,3-dimethylindol-7-amine (CID 83815699) is 1,3-dimethylindol-7-amine.
What is the SMILES notation for 1,3-dimethylindol-7-amine?
The canonical SMILES for 1,3-dimethylindol-7-amine is Cc1cn(C)c2c(N)cccc12.
What is the InChIKey of 1,3-dimethylindol-7-amine?
The InChIKey is YMRVIXQJLTVNRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-6-12(2)10-8(7)4-3-5-9(10)11/h3-6H,11H2,1-2H3.
What are the key properties of 1,3-dimethylindol-7-amine?
1,3-dimethylindol-7-amine has a molecular weight of 160.22 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylindol-7-amine is sourced from PubChem (CID 83815699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).