C22H29N — CID 142290146
1,8-ditert-butyl-9-ethylcarbazole (PubChem CID 142290146) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 1,8-ditert-butyl-9-ethylcarbazole.
| Compound Name | 1,8-ditert-butyl-9-ethylcarbazole |
|---|---|
| PubChem CID | 142290146 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1,8-ditert-butyl-9-ethylcarbazole |
| SMILES | CCn1c2c(C(C)(C)C)cccc2c2cccc(C(C)(C)C)c21 |
| InChI | InChI=1S/C22H29N/c1-8-23-19-15(11-9-13-17(19)21(2,3)4)16-12-10-14-18(20(16)23)22(5,6)7/h9-14H,8H2,1-7H3 |
| InChIKey | XAGQWWZMAQVXIB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |