C19H27N — CID 129258354
3,8-ditert-butyl-4-ethylquinoline (PubChem CID 129258354) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 3,8-ditert-butyl-4-ethylquinoline.
| Compound Name | 3,8-ditert-butyl-4-ethylquinoline |
|---|---|
| PubChem CID | 129258354 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 3,8-ditert-butyl-4-ethylquinoline |
| SMILES | CCc1c(C(C)(C)C)cnc2c(C(C)(C)C)cccc12 |
| InChI | InChI=1S/C19H27N/c1-8-13-14-10-9-11-15(18(2,3)4)17(14)20-12-16(13)19(5,6)7/h9-12H,8H2,1-7H3 |
| InChIKey | GONGITRVOFBIPL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |