C13H15NO — CID 139902444
3,4-diethylquinolin-8-ol (PubChem CID 139902444) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 3,4-diethylquinolin-8-ol.
| Compound Name | 3,4-diethylquinolin-8-ol |
|---|---|
| PubChem CID | 139902444 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3,4-diethylquinolin-8-ol |
| SMILES | CCc1cnc2c(O)cccc2c1CC |
| InChI | InChI=1S/C13H15NO/c1-3-9-8-14-13-11(10(9)4-2)6-5-7-12(13)15/h5-8,15H,3-4H2,1-2H3 |
| InChIKey | RYVQGGDLMUALAN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |