About 4-tridecylquinolin-8-ol
4-tridecylquinolin-8-ol (PubChem CID 102274119) has the molecular formula C22H33NO
and a molecular weight of 327.51 g/mol. Its IUPAC name is 4-tridecylquinolin-8-ol.
Molecular Properties
| Compound Name | 4-tridecylquinolin-8-ol |
| PubChem CID | 102274119 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 4-tridecylquinolin-8-ol |
| SMILES | CCCCCCCCCCCCCc1ccnc2c(O)cccc12 |
| InChI | InChI=1S/C22H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-14-19-17-18-23-22-20(19)15-13-16-21(22)24/h13,15-18,24H,2-12,14H2,1H3 |
| InChIKey | NWSNSYNIXJMITB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-tridecylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tridecylquinolin-8-ol?
The IUPAC name of 4-tridecylquinolin-8-ol (CID 102274119) is 4-tridecylquinolin-8-ol.
What is the SMILES notation for 4-tridecylquinolin-8-ol?
The canonical SMILES for 4-tridecylquinolin-8-ol is CCCCCCCCCCCCCc1ccnc2c(O)cccc12.
What is the InChIKey of 4-tridecylquinolin-8-ol?
The InChIKey is NWSNSYNIXJMITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-14-19-17-18-23-22-20(19)15-13-16-21(22)24/h13,15-18,24H,2-12,14H2,1H3.
What are the key properties of 4-tridecylquinolin-8-ol?
4-tridecylquinolin-8-ol has a molecular weight of 327.51 g/mol, XLogP of 6.79, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tridecylquinolin-8-ol is sourced from PubChem (CID 102274119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).